C29H32N2O7 — CID 162895501
(2S,3'R,6R,9R)-3'-[[3-(diaminomethyl)phenyl]methyl]-20-hydroxy-10,10,16-trimethylspiro[8,11,15-trioxatetracyclo[10.8.0.02,9.014,19]icosa-1(12),13,16,19-tetraene-6,2'-oxirane]-7,18-dione (PubChem CID 162895501) has the molecular formula C29H32N2O7 and a molecular weight of 520.58 g/mol. Its IUPAC name is (2S,3'R,6R,9R)-3'-[[3-(diaminomethyl)phenyl]methyl]-20-hydroxy-10,10,16-trimethylspiro[8,11,15-trioxatetracyclo[10.8.0.02,9.014,19]icosa-1(12),13,16,19-tetraene-6,2'-oxirane]-7,18-dione.
| Compound Name | (2S,3'R,6R,9R)-3'-[[3-(diaminomethyl)phenyl]methyl]-20-hydroxy-10,10,16-trimethylspiro[8,11,15-trioxatetracyclo[10.8.0.02,9.014,19]icosa-1(12),13,16,19-tetraene-6,2'-oxirane]-7,18-dione |
|---|---|
| PubChem CID | 162895501 |
| Molecular Formula | C29H32N2O7 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (2S,3'R,6R,9R)-3'-[[3-(diaminomethyl)phenyl]methyl]-20-hydroxy-10,10,16-trimethylspiro[8,11,15-trioxatetracyclo[10.8.0.02,9.014,19]icosa-1(12),13,16,19-tetraene-6,2'-oxirane]-7,18-dione |
| SMILES | Cc1cc(=O)c2c(O)c3c(cc2o1)OC(C)(C)[C@@H]1OC(=O)[C@]2(CCC[C@@H]31)O[C@@H]2Cc1cccc(C(N)N)c1 |
| InChI | InChI=1S/C29H32N2O7/c1-14-10-18(32)23-19(35-14)13-20-22(24(23)33)17-8-5-9-29(27(34)36-25(17)28(2,3)37-20)21(38-29)12-15-6-4-7-16(11-15)26(30)31/h4,6-7,10-11,13,17,21,25-26,33H,5,8-9,12,30-31H2,1-3H3/t17-,21+,25+,29+/m0/s1 |
| InChIKey | YSNMWOIANJQSLQ-QNIYTKNISA-N |
| XLogP | 3.45 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|