C26H33N3O7 — CID 163073341
2-[3-(21-hydroxy-11,11,17-trimethyl-8,19-dioxospiro[9,12,16-trioxatetracyclo[11.8.0.02,10.015,20]henicosa-1(13),14,17,20-tetraene-7,3'-oxirane]-2'-yl)propyl]guanidine (PubChem CID 163073341) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is 2-[3-(21-hydroxy-11,11,17-trimethyl-8,19-dioxospiro[9,12,16-trioxatetracyclo[11.8.0.02,10.015,20]henicosa-1(13),14,17,20-tetraene-7,3'-oxirane]-2'-yl)propyl]guanidine.
| Compound Name | 2-[3-(21-hydroxy-11,11,17-trimethyl-8,19-dioxospiro[9,12,16-trioxatetracyclo[11.8.0.02,10.015,20]henicosa-1(13),14,17,20-tetraene-7,3'-oxirane]-2'-yl)propyl]guanidine |
|---|---|
| PubChem CID | 163073341 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-[3-(21-hydroxy-11,11,17-trimethyl-8,19-dioxospiro[9,12,16-trioxatetracyclo[11.8.0.02,10.015,20]henicosa-1(13),14,17,20-tetraene-7,3'-oxirane]-2'-yl)propyl]guanidine |
| SMILES | Cc1cc(=O)c2c(O)c3c(cc2o1)OC(C)(C)C1OC(=O)C2(CCCCC31)OC2CCCN=C(N)N |
| InChI | InChI=1S/C26H33N3O7/c1-13-11-15(30)20-16(33-13)12-17-19(21(20)31)14-7-4-5-9-26(18(36-26)8-6-10-29-24(27)28)23(32)34-22(14)25(2,3)35-17/h11-12,14,18,22,31H,4-10H2,1-3H3,(H4,27,28,29) |
| InChIKey | LRQNLTUPZIEXNF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 162.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|