C32H34N2O7 — CID 162796320
3'-[(1-amino-1,2-dihydroisoquinolin-5-yl)methyl]-21-hydroxy-11,11,17-trimethylspiro[9,12,16-trioxatetracyclo[11.8.0.02,10.015,20]henicosa-1(13),14,17,20-tetraene-7,2'-oxirane]-8,19-dione (PubChem CID 162796320) has the molecular formula C32H34N2O7 and a molecular weight of 558.63 g/mol. Its IUPAC name is 3'-[(1-amino-1,2-dihydroisoquinolin-5-yl)methyl]-21-hydroxy-11,11,17-trimethylspiro[9,12,16-trioxatetracyclo[11.8.0.02,10.015,20]henicosa-1(13),14,17,20-tetraene-7,2'-oxirane]-8,19-dione.
| Compound Name | 3'-[(1-amino-1,2-dihydroisoquinolin-5-yl)methyl]-21-hydroxy-11,11,17-trimethylspiro[9,12,16-trioxatetracyclo[11.8.0.02,10.015,20]henicosa-1(13),14,17,20-tetraene-7,2'-oxirane]-8,19-dione |
|---|---|
| PubChem CID | 162796320 |
| Molecular Formula | C32H34N2O7 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 3'-[(1-amino-1,2-dihydroisoquinolin-5-yl)methyl]-21-hydroxy-11,11,17-trimethylspiro[9,12,16-trioxatetracyclo[11.8.0.02,10.015,20]henicosa-1(13),14,17,20-tetraene-7,2'-oxirane]-8,19-dione |
| SMILES | Cc1cc(=O)c2c(O)c3c(cc2o1)OC(C)(C)C1OC(=O)C2(CCCCC31)OC2Cc1cccc2c1C=CNC2N |
| InChI | InChI=1S/C32H34N2O7/c1-16-13-21(35)26-22(38-16)15-23-25(27(26)36)20-8-4-5-11-32(30(37)39-28(20)31(2,3)40-23)24(41-32)14-17-7-6-9-19-18(17)10-12-34-29(19)33/h6-7,9-10,12-13,15,20,24,28-29,34,36H,4-5,8,11,14,33H2,1-3H3 |
| InChIKey | KCTNQOSWIQKURD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|