C34H32N2O7 — CID 162890671
(5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-[2-(2-aminobenzo[h]quinolin-4-yl)ethyl]-2-methyloxirane-2-carboxylate (PubChem CID 162890671) has the molecular formula C34H32N2O7 and a molecular weight of 580.64 g/mol. Its IUPAC name is (5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-[2-(2-aminobenzo[h]quinolin-4-yl)ethyl]-2-methyloxirane-2-carboxylate.
| Compound Name | (5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-[2-(2-aminobenzo[h]quinolin-4-yl)ethyl]-2-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 162890671 |
| Molecular Formula | C34H32N2O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | (5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-[2-(2-aminobenzo[h]quinolin-4-yl)ethyl]-2-methyloxirane-2-carboxylate |
| SMILES | Cc1cc(=O)c2c(O)c3c(cc2o1)OC(C)(C)C(OC(=O)C1(C)OC1CCc1cc(N)nc2c1ccc1ccccc12)C3 |
| InChI | InChI=1S/C34H32N2O7/c1-17-13-23(37)29-25(40-17)16-24-22(31(29)38)15-27(33(2,3)42-24)41-32(39)34(4)26(43-34)12-10-19-14-28(35)36-30-20-8-6-5-7-18(20)9-11-21(19)30/h5-9,11,13-14,16,26-27,38H,10,12,15H2,1-4H3,(H2,35,36) |
| InChIKey | PXYZKBBIXLCRBV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|