C25H28O9 — CID 162856261
[(3S)-5-hydroxy-2,2-dimethyl-8-(2-methylbut-2-enoyloxymethyl)-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (2S,3S)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 162856261) has the molecular formula C25H28O9 and a molecular weight of 472.49 g/mol. Its IUPAC name is [(3S)-5-hydroxy-2,2-dimethyl-8-(2-methylbut-2-enoyloxymethyl)-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (2S,3S)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [(3S)-5-hydroxy-2,2-dimethyl-8-(2-methylbut-2-enoyloxymethyl)-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (2S,3S)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 162856261 |
| Molecular Formula | C25H28O9 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [(3S)-5-hydroxy-2,2-dimethyl-8-(2-methylbut-2-enoyloxymethyl)-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (2S,3S)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | CC=C(C)C(=O)OCc1cc(=O)c2c(O)c3c(cc2o1)OC(C)(C)[C@@H](OC(=O)[C@@]1(C)O[C@H]1C)C3 |
| InChI | InChI=1S/C25H28O9/c1-7-12(2)22(28)30-11-14-8-16(26)20-18(31-14)10-17-15(21(20)27)9-19(24(4,5)34-17)32-23(29)25(6)13(3)33-25/h7-8,10,13,19,27H,9,11H2,1-6H3/t13-,19-,25-/m0/s1 |
| InChIKey | HHRIEKBNNZXBCO-JIRBFAAZSA-N |
| XLogP | 3.31 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|