C20H30O8S — CID 162851174
[2-hydroxy-2-(2-hydroxy-1,5,12-trimethyl-11-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-5-yl)ethyl] hydrogen sulfate (PubChem CID 162851174) has the molecular formula C20H30O8S and a molecular weight of 430.52 g/mol. Its IUPAC name is [2-hydroxy-2-(2-hydroxy-1,5,12-trimethyl-11-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-5-yl)ethyl] hydrogen sulfate.
| Compound Name | [2-hydroxy-2-(2-hydroxy-1,5,12-trimethyl-11-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-5-yl)ethyl] hydrogen sulfate |
|---|---|
| PubChem CID | 162851174 |
| Molecular Formula | C20H30O8S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [2-hydroxy-2-(2-hydroxy-1,5,12-trimethyl-11-oxo-10-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-en-5-yl)ethyl] hydrogen sulfate |
| SMILES | CC1(C(O)COS(=O)(=O)O)CCC2(O)C(=CC3OC(=O)C4(C)CCCC2(C)C34)C1 |
| InChI | InChI=1S/C20H30O8S/c1-17(14(21)11-27-29(24,25)26)7-8-20(23)12(10-17)9-13-15-18(2,16(22)28-13)5-4-6-19(15,20)3/h9,13-15,21,23H,4-8,10-11H2,1-3H3,(H,24,25,26) |
| InChIKey | JZLLZWSDWGNULG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|