C18H35N5O6 — CID 162851895
N-[(2S,3R,6S)-2-[(1R,2R,3R,4R,6S)-6-amino-2-hydroxy-4-methoxy-3-(methylamino)cyclohexyl]oxy-6-(methylaminomethyl)oxan-3-yl]-2-formamidoacetamide (PubChem CID 162851895) has the molecular formula C18H35N5O6 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[(2S,3R,6S)-2-[(1R,2R,3R,4R,6S)-6-amino-2-hydroxy-4-methoxy-3-(methylamino)cyclohexyl]oxy-6-(methylaminomethyl)oxan-3-yl]-2-formamidoacetamide.
| Compound Name | N-[(2S,3R,6S)-2-[(1R,2R,3R,4R,6S)-6-amino-2-hydroxy-4-methoxy-3-(methylamino)cyclohexyl]oxy-6-(methylaminomethyl)oxan-3-yl]-2-formamidoacetamide |
|---|---|
| PubChem CID | 162851895 |
| Molecular Formula | C18H35N5O6 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | N-[(2S,3R,6S)-2-[(1R,2R,3R,4R,6S)-6-amino-2-hydroxy-4-methoxy-3-(methylamino)cyclohexyl]oxy-6-(methylaminomethyl)oxan-3-yl]-2-formamidoacetamide |
| SMILES | CNC[C@@H]1CC[C@@H](NC(=O)CNC=O)[C@H](O[C@H]2[C@H](O)[C@@H](NC)[C@H](OC)C[C@@H]2N)O1 |
| InChI | InChI=1S/C18H35N5O6/c1-20-7-10-4-5-12(23-14(25)8-22-9-24)18(28-10)29-17-11(19)6-13(27-3)15(21-2)16(17)26/h9-13,15-18,20-21,26H,4-8,19H2,1-3H3,(H,22,24)(H,23,25)/t10-,11-,12+,13+,15-,16+,17+,18-/m0/s1 |
| InChIKey | NKRBCHAZRNKYCR-OFTAEMBNSA-N |
| XLogP | -2.98 |
| TPSA | 156.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|