C35H52O3 — CID 162853437
6'-hydroxy-1',4',5,8a,11'-pentamethyl-7'-propan-2-ylspiro[4,4a,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-3,15'-tetracyclo[11.2.1.02,12.04,8]hexadec-2(12)-ene]-2-one (PubChem CID 162853437) has the molecular formula C35H52O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is 6'-hydroxy-1',4',5,8a,11'-pentamethyl-7'-propan-2-ylspiro[4,4a,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-3,15'-tetracyclo[11.2.1.02,12.04,8]hexadec-2(12)-ene]-2-one.
| Compound Name | 6'-hydroxy-1',4',5,8a,11'-pentamethyl-7'-propan-2-ylspiro[4,4a,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-3,15'-tetracyclo[11.2.1.02,12.04,8]hexadec-2(12)-ene]-2-one |
|---|---|
| PubChem CID | 162853437 |
| Molecular Formula | C35H52O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | 6'-hydroxy-1',4',5,8a,11'-pentamethyl-7'-propan-2-ylspiro[4,4a,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-3,15'-tetracyclo[11.2.1.02,12.04,8]hexadec-2(12)-ene]-2-one |
| SMILES | CC1=CCCC2(C)CC3OC(=O)C4(CC5CC4(C)C4=C5C(C)CCC5C(C(C)C)C(O)CC5(C)C4)C3CC12 |
| InChI | InChI=1S/C35H52O3/c1-19(2)29-23-11-10-21(4)30-22-14-34(7,26(30)16-33(23,6)17-27(29)36)35(15-22)25-13-24-20(3)9-8-12-32(24,5)18-28(25)38-31(35)37/h9,19,21-25,27-29,36H,8,10-18H2,1-7H3 |
| InChIKey | HIWMYGWPPTZIGR-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|