C41H65NO13 — CID 162854748
6-[26-[2-(3,4-dihydroxyphenyl)ethylamino]-25-methoxy-10,16,26-trioxohexacos-21-enoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 162854748) has the molecular formula C41H65NO13 and a molecular weight of 779.96 g/mol. Its IUPAC name is 6-[26-[2-(3,4-dihydroxyphenyl)ethylamino]-25-methoxy-10,16,26-trioxohexacos-21-enoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[26-[2-(3,4-dihydroxyphenyl)ethylamino]-25-methoxy-10,16,26-trioxohexacos-21-enoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162854748 |
| Molecular Formula | C41H65NO13 |
| Molecular Weight | 779.96 g/mol |
| Exact Mass | 779.45 |
| IUPAC Name | 6-[26-[2-(3,4-dihydroxyphenyl)ethylamino]-25-methoxy-10,16,26-trioxohexacos-21-enoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | COC(CCC=CCCCCC(=O)CCCCCC(=O)CCCCCCCCCOC1OC(C(=O)O)C(O)C(O)C1O)C(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C41H65NO13/c1-53-34(39(50)42-26-25-29-23-24-32(45)33(46)28-29)22-16-9-5-4-8-13-19-31(44)21-15-11-14-20-30(43)18-12-7-3-2-6-10-17-27-54-41-37(49)35(47)36(48)38(55-41)40(51)52/h5,9,23-24,28,34-38,41,45-49H,2-4,6-8,10-22,25-27H2,1H3,(H,42,50)(H,51,52) |
| InChIKey | OGLFWQCCAZLOPQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 229.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.96 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|