C26H38O6 — CID 162855722
(7,11-diacetyloxy-2,6,12-trimethyl-16-methylidene-3-tricyclo[7.5.2.012,15]hexadec-5-enyl) acetate (PubChem CID 162855722) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (7,11-diacetyloxy-2,6,12-trimethyl-16-methylidene-3-tricyclo[7.5.2.012,15]hexadec-5-enyl) acetate.
| Compound Name | (7,11-diacetyloxy-2,6,12-trimethyl-16-methylidene-3-tricyclo[7.5.2.012,15]hexadec-5-enyl) acetate |
|---|---|
| PubChem CID | 162855722 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (7,11-diacetyloxy-2,6,12-trimethyl-16-methylidene-3-tricyclo[7.5.2.012,15]hexadec-5-enyl) acetate |
| SMILES | C=C1C2CC(OC(C)=O)C(C)=CCC(OC(C)=O)C(C)C3CCC(C)(C(OC(C)=O)C2)C13 |
| InChI | InChI=1S/C26H38O6/c1-14-8-9-22(30-17(4)27)16(3)21-10-11-26(7)24(32-19(6)29)13-20(15(2)25(21)26)12-23(14)31-18(5)28/h8,16,20-25H,2,9-13H2,1,3-7H3 |
| InChIKey | KMKCGFJCBRVWDE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|