C25H38O6 — CID 163094390
(8-acetyloxy-3-hydroxy-4,9,13-trimethyl-16-methylidene-5-oxatetracyclo[8.5.2.04,6.013,17]heptadecan-14-yl) propanoate (PubChem CID 163094390) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is (8-acetyloxy-3-hydroxy-4,9,13-trimethyl-16-methylidene-5-oxatetracyclo[8.5.2.04,6.013,17]heptadecan-14-yl) propanoate.
| Compound Name | (8-acetyloxy-3-hydroxy-4,9,13-trimethyl-16-methylidene-5-oxatetracyclo[8.5.2.04,6.013,17]heptadecan-14-yl) propanoate |
|---|---|
| PubChem CID | 163094390 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (8-acetyloxy-3-hydroxy-4,9,13-trimethyl-16-methylidene-5-oxatetracyclo[8.5.2.04,6.013,17]heptadecan-14-yl) propanoate |
| SMILES | C=C1C2CC(OC(=O)CC)C3(C)CCC(C(C)C(OC(C)=O)CC4OC4(C)C(O)C2)C13 |
| InChI | InChI=1S/C25H38O6/c1-7-22(28)30-20-11-16-10-19(27)25(6)21(31-25)12-18(29-15(4)26)14(3)17-8-9-24(20,5)23(17)13(16)2/h14,16-21,23,27H,2,7-12H2,1,3-6H3 |
| InChIKey | UBGDJRVUVJERAK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|