C31H36O9 — CID 162857565
[4-[6-[3,5-dimethoxy-4-(2-methylbut-2-enoyloxy)phenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenyl] 2-methylbut-2-enoate (PubChem CID 162857565) has the molecular formula C31H36O9 and a molecular weight of 552.62 g/mol. Its IUPAC name is [4-[6-[3,5-dimethoxy-4-(2-methylbut-2-enoyloxy)phenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenyl] 2-methylbut-2-enoate.
| Compound Name | [4-[6-[3,5-dimethoxy-4-(2-methylbut-2-enoyloxy)phenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenyl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162857565 |
| Molecular Formula | C31H36O9 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | [4-[6-[3,5-dimethoxy-4-(2-methylbut-2-enoyloxy)phenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)Oc1ccc(C2OCC3C(c4cc(OC)c(OC(=O)C(C)=CC)c(OC)c4)OCC23)cc1OC |
| InChI | InChI=1S/C31H36O9/c1-8-17(3)30(32)39-23-11-10-19(12-24(23)34-5)27-21-15-38-28(22(21)16-37-27)20-13-25(35-6)29(26(14-20)36-7)40-31(33)18(4)9-2/h8-14,21-22,27-28H,15-16H2,1-7H3 |
| InChIKey | UOTSCHVSQHLKAK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|