C20H28O5 — CID 162858496
[(1S,2S,5S,6R,7S,10R,12R,14S)-5,14-dimethyl-9-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-7-yl] 3-methylbutanoate (PubChem CID 162858496) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(1S,2S,5S,6R,7S,10R,12R,14S)-5,14-dimethyl-9-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-7-yl] 3-methylbutanoate.
| Compound Name | [(1S,2S,5S,6R,7S,10R,12R,14S)-5,14-dimethyl-9-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-7-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162858496 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(1S,2S,5S,6R,7S,10R,12R,14S)-5,14-dimethyl-9-methylidene-4-oxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-7-yl] 3-methylbutanoate |
| SMILES | C=C1C[C@H](OC(=O)CC(C)C)[C@@H]2[C@H](OC(=O)[C@H]2C)[C@@H]2[C@H]1C[C@H]1O[C@@]21C |
| InChI | InChI=1S/C20H28O5/c1-9(2)6-15(21)23-13-7-10(3)12-8-14-20(5,25-14)17(12)18-16(13)11(4)19(22)24-18/h9,11-14,16-18H,3,6-8H2,1-2,4-5H3/t11-,12-,13-,14+,16+,17-,18-,20+/m0/s1 |
| InChIKey | FLCDHJSSRHACJF-DMYRLNDZSA-N |
| XLogP | 2.88 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|