C21H28O7 — CID 162860150
[(1R,2S,5R,6R,7S,11R)-11-methoxy-5-(methoxymethyl)-9,13-dimethyl-4-oxo-3,14-dioxatricyclo[9.2.1.02,6]tetradeca-9,12-dien-7-yl] 2-methylprop-2-enoate (PubChem CID 162860150) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is [(1R,2S,5R,6R,7S,11R)-11-methoxy-5-(methoxymethyl)-9,13-dimethyl-4-oxo-3,14-dioxatricyclo[9.2.1.02,6]tetradeca-9,12-dien-7-yl] 2-methylprop-2-enoate.
| Compound Name | [(1R,2S,5R,6R,7S,11R)-11-methoxy-5-(methoxymethyl)-9,13-dimethyl-4-oxo-3,14-dioxatricyclo[9.2.1.02,6]tetradeca-9,12-dien-7-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162860150 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [(1R,2S,5R,6R,7S,11R)-11-methoxy-5-(methoxymethyl)-9,13-dimethyl-4-oxo-3,14-dioxatricyclo[9.2.1.02,6]tetradeca-9,12-dien-7-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1CC(C)=C[C@]2(OC)C=C(C)[C@@H](O2)[C@H]2OC(=O)[C@@H](COC)[C@@H]21 |
| InChI | InChI=1S/C21H28O7/c1-11(2)19(22)26-15-7-12(3)8-21(25-6)9-13(4)17(28-21)18-16(15)14(10-24-5)20(23)27-18/h8-9,14-18H,1,7,10H2,2-6H3/t14-,15-,16+,17+,18-,21+/m0/s1 |
| InChIKey | AAEMRPHODGDJOW-CQCYXHDOSA-N |
| XLogP | 2.32 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|