C31H40O8 — CID 162860896
[(1S,2S,5S,6S,7S,8S,9R,12R)-2,8,12-trihydroxy-2,10,10-trimethyl-5,7-bis(phenylmethoxy)-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate (PubChem CID 162860896) has the molecular formula C31H40O8 and a molecular weight of 540.65 g/mol. Its IUPAC name is [(1S,2S,5S,6S,7S,8S,9R,12R)-2,8,12-trihydroxy-2,10,10-trimethyl-5,7-bis(phenylmethoxy)-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate.
| Compound Name | [(1S,2S,5S,6S,7S,8S,9R,12R)-2,8,12-trihydroxy-2,10,10-trimethyl-5,7-bis(phenylmethoxy)-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
|---|---|
| PubChem CID | 162860896 |
| Molecular Formula | C31H40O8 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | [(1S,2S,5S,6S,7S,8S,9R,12R)-2,8,12-trihydroxy-2,10,10-trimethyl-5,7-bis(phenylmethoxy)-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12[C@@H](OCc3ccccc3)CC[C@](C)(O)[C@]13OC(C)(C)[C@H]([C@H](O)[C@H]2OCc1ccccc1)[C@H]3O |
| InChI | InChI=1S/C31H40O8/c1-20(32)38-19-30-23(36-17-21-11-7-5-8-12-21)15-16-29(4,35)31(30)26(34)24(28(2,3)39-31)25(33)27(30)37-18-22-13-9-6-10-14-22/h5-14,23-27,33-35H,15-19H2,1-4H3/t23-,24+,25-,26+,27+,29-,30-,31-/m0/s1 |
| InChIKey | DFFNKAXBULMFDB-DHBPSFSWSA-N |
| XLogP | 3.15 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |