C29H40O9 — CID 162844333
[(1S,2S,5S,6S,7S,8R,9R,12R)-8-acetyloxy-2,5-dihydroxy-2,10,10-trimethyl-7-phenylmethoxy-12-prop-1-en-2-yloxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate (PubChem CID 162844333) has the molecular formula C29H40O9 and a molecular weight of 532.63 g/mol. Its IUPAC name is [(1S,2S,5S,6S,7S,8R,9R,12R)-8-acetyloxy-2,5-dihydroxy-2,10,10-trimethyl-7-phenylmethoxy-12-prop-1-en-2-yloxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate.
| Compound Name | [(1S,2S,5S,6S,7S,8R,9R,12R)-8-acetyloxy-2,5-dihydroxy-2,10,10-trimethyl-7-phenylmethoxy-12-prop-1-en-2-yloxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
|---|---|
| PubChem CID | 162844333 |
| Molecular Formula | C29H40O9 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [(1S,2S,5S,6S,7S,8R,9R,12R)-8-acetyloxy-2,5-dihydroxy-2,10,10-trimethyl-7-phenylmethoxy-12-prop-1-en-2-yloxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
| SMILES | C=C(C)O[C@@H]1[C@H]2[C@@H](OC(C)=O)[C@@H](OCc3ccccc3)[C@]3(COC(C)=O)[C@@H](O)CC[C@](C)(O)[C@@]13OC2(C)C |
| InChI | InChI=1S/C29H40O9/c1-17(2)36-24-22-23(37-19(4)31)25(34-15-20-11-9-8-10-12-20)28(16-35-18(3)30)21(32)13-14-27(7,33)29(24,28)38-26(22,5)6/h8-12,21-25,32-33H,1,13-16H2,2-7H3/t21-,22+,23+,24+,25+,27-,28-,29-/m0/s1 |
| InChIKey | OWLIYLQIDSRZML-DVWAOWRDSA-N |
| XLogP | 3.05 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|