C34H44O8 — CID 163068104
[2,5-dihydroxy-2,10,10-trimethyl-7,8-bis(phenylmethoxy)-12-prop-1-en-2-yloxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate (PubChem CID 163068104) has the molecular formula C34H44O8 and a molecular weight of 580.72 g/mol. Its IUPAC name is [2,5-dihydroxy-2,10,10-trimethyl-7,8-bis(phenylmethoxy)-12-prop-1-en-2-yloxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate.
| Compound Name | [2,5-dihydroxy-2,10,10-trimethyl-7,8-bis(phenylmethoxy)-12-prop-1-en-2-yloxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
|---|---|
| PubChem CID | 163068104 |
| Molecular Formula | C34H44O8 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | [2,5-dihydroxy-2,10,10-trimethyl-7,8-bis(phenylmethoxy)-12-prop-1-en-2-yloxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
| SMILES | C=C(C)OC1C2C(OCc3ccccc3)C(OCc3ccccc3)C3(COC(C)=O)C(O)CCC(C)(O)C13OC2(C)C |
| InChI | InChI=1S/C34H44O8/c1-22(2)41-29-27-28(38-19-24-13-9-7-10-14-24)30(39-20-25-15-11-8-12-16-25)33(21-40-23(3)35)26(36)17-18-32(6,37)34(29,33)42-31(27,4)5/h7-16,26-30,36-37H,1,17-21H2,2-6H3 |
| InChIKey | ADYPYXUVXNIRMH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|