C28H42ClNO8 — CID 162863162
2-[6-[5-[5-(4-acetyloxypent-2-enoylamino)-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-4-(chloromethyl)-4-hydroxyoxan-2-yl]acetic acid (PubChem CID 162863162) has the molecular formula C28H42ClNO8 and a molecular weight of 556.10 g/mol. Its IUPAC name is 2-[6-[5-[5-(4-acetyloxypent-2-enoylamino)-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-4-(chloromethyl)-4-hydroxyoxan-2-yl]acetic acid.
| Compound Name | 2-[6-[5-[5-(4-acetyloxypent-2-enoylamino)-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-4-(chloromethyl)-4-hydroxyoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 162863162 |
| Molecular Formula | C28H42ClNO8 |
| Molecular Weight | 556.10 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 2-[6-[5-[5-(4-acetyloxypent-2-enoylamino)-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-4-(chloromethyl)-4-hydroxyoxan-2-yl]acetic acid |
| SMILES | CC(=O)OC(C)C=CC(=O)NC1CC(C)C(CC=C(C)C=CC2CC(O)(CCl)CC(CC(=O)O)O2)OC1C |
| InChI | InChI=1S/C28H42ClNO8/c1-17(6-9-22-14-28(35,16-29)15-23(38-22)13-27(33)34)7-10-25-18(2)12-24(20(4)37-25)30-26(32)11-8-19(3)36-21(5)31/h6-9,11,18-20,22-25,35H,10,12-16H2,1-5H3,(H,30,32)(H,33,34) |
| InChIKey | NEWBYXGSZKUMLD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.10 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|