C16H26N4O2S — CID 162864154
4,4-dimethyl-2-methylsulfonyl-8-(pyridin-2-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine (PubChem CID 162864154) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is 4,4-dimethyl-2-methylsulfonyl-8-(pyridin-2-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine.
| Compound Name | 4,4-dimethyl-2-methylsulfonyl-8-(pyridin-2-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 162864154 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 4,4-dimethyl-2-methylsulfonyl-8-(pyridin-2-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine |
| SMILES | CC1(C)CN(S(C)(=O)=O)CC2CN(Cc3ccccn3)CCN21 |
| InChI | InChI=1S/C16H26N4O2S/c1-16(2)13-19(23(3,21)22)12-15-11-18(8-9-20(15)16)10-14-6-4-5-7-17-14/h4-7,15H,8-13H2,1-3H3 |
| InChIKey | OIKCOHUJTRSCFI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |