C15H26O3 — CID 162865174
(1R,4aS,5S,7S,8aS)-5-hydroxy-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 162865174) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1R,4aS,5S,7S,8aS)-5-hydroxy-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (1R,4aS,5S,7S,8aS)-5-hydroxy-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 162865174 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1R,4aS,5S,7S,8aS)-5-hydroxy-7-(2-hydroxypropan-2-yl)-1,4a-dimethyl-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | C[C@H]1C(=O)CC[C@]2(C)[C@@H](O)C[C@@H](C(C)(C)O)C[C@@H]12 |
| InChI | InChI=1S/C15H26O3/c1-9-11-7-10(14(2,3)18)8-13(17)15(11,4)6-5-12(9)16/h9-11,13,17-18H,5-8H2,1-4H3/t9-,10+,11+,13+,15+/m1/s1 |
| InChIKey | WRFQQRDGCBXBGO-NEQUNRTCSA-N |
| XLogP | 2.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |