C18H27NO3 — CID 162866486
1-[(1S,10S,11R,13S,14R,15S)-11,14-dihydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-3-yl]ethanone (PubChem CID 162866486) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-[(1S,10S,11R,13S,14R,15S)-11,14-dihydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-3-yl]ethanone.
| Compound Name | 1-[(1S,10S,11R,13S,14R,15S)-11,14-dihydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-3-yl]ethanone |
|---|---|
| PubChem CID | 162866486 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 1-[(1S,10S,11R,13S,14R,15S)-11,14-dihydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-3-yl]ethanone |
| SMILES | CC(=O)C1=C2[C@@H]3C[C@@H](O)[C@H]4CCCN(CC1)[C@]24C[C@H](C)[C@H]3O |
| InChI | InChI=1S/C18H27NO3/c1-10-9-18-14-4-3-6-19(18)7-5-12(11(2)20)16(18)13(17(10)22)8-15(14)21/h10,13-15,17,21-22H,3-9H2,1-2H3/t10-,13-,14+,15+,17+,18-/m0/s1 |
| InChIKey | BUSXDCQPRDUONH-FJPIFFLYSA-N |
| XLogP | 1.51 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |