About (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate
(14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate (PubChem CID 162921888) has the molecular formula C20H31NO5
and a molecular weight of 365.47 g/mol. Its IUPAC name is (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate.
Molecular Properties
| Compound Name | (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate |
| PubChem CID | 162921888 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate |
| SMILES | CC(=O)OC1CC2C(OC(C)=O)C(C)CC34C1CCCN3CCC(O)C24 |
| InChI | InChI=1S/C20H31NO5/c1-11-10-20-15-5-4-7-21(20)8-6-16(24)18(20)14(19(11)26-13(3)23)9-17(15)25-12(2)22/h11,14-19,24H,4-10H2,1-3H3 |
| InChIKey | SDMGHZKLXCHNCW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate?
The IUPAC name of (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate (CID 162921888) is (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate.
What is the SMILES notation for (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate?
The canonical SMILES for (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate is CC(=O)OC1CC2C(OC(C)=O)C(C)CC34C1CCCN3CCC(O)C24.
What is the InChIKey of (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate?
The InChIKey is SDMGHZKLXCHNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NO5/c1-11-10-20-15-5-4-7-21(20)8-6-16(24)18(20)14(19(11)26-13(3)23)9-17(15)25-12(2)22/h11,14-19,24H,4-10H2,1-3H3.
What are the key properties of (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate?
(14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate has a molecular weight of 365.47 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (14-acetyloxy-3-hydroxy-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadecan-11-yl) acetate is sourced from PubChem (CID 162921888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).