C10H10O4 — CID 162867718
2-[(3S)-3,4-dihydroxybut-1-ynyl]benzene-1,4-diol (PubChem CID 162867718) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-[(3S)-3,4-dihydroxybut-1-ynyl]benzene-1,4-diol.
| Compound Name | 2-[(3S)-3,4-dihydroxybut-1-ynyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 162867718 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-[(3S)-3,4-dihydroxybut-1-ynyl]benzene-1,4-diol |
| SMILES | OC[C@@H](O)C#Cc1cc(O)ccc1O |
| InChI | InChI=1S/C10H10O4/c11-6-9(13)2-1-7-5-8(12)3-4-10(7)14/h3-5,9,11-14H,6H2/t9-/m0/s1 |
| InChIKey | GJFXLXKAXXAFPU-VIFPVBQESA-N |
| XLogP | -0.20 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|