C31H46O4 — CID 162871046
2-[(2R)-5-acetyl-2,3-dihydro-1-benzofuran-2-yl]prop-2-enyl octadec-9-enoate (PubChem CID 162871046) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is 2-[(2R)-5-acetyl-2,3-dihydro-1-benzofuran-2-yl]prop-2-enyl octadec-9-enoate.
| Compound Name | 2-[(2R)-5-acetyl-2,3-dihydro-1-benzofuran-2-yl]prop-2-enyl octadec-9-enoate |
|---|---|
| PubChem CID | 162871046 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 2-[(2R)-5-acetyl-2,3-dihydro-1-benzofuran-2-yl]prop-2-enyl octadec-9-enoate |
| SMILES | C=C(COC(=O)CCCCCCCC=CCCCCCCCC)[C@H]1Cc2cc(C(C)=O)ccc2O1 |
| InChI | InChI=1S/C31H46O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-31(33)34-24-25(2)30-23-28-22-27(26(3)32)20-21-29(28)35-30/h11-12,20-22,30H,2,4-10,13-19,23-24H2,1,3H3/t30-/m1/s1 |
| InChIKey | XHZDCOHEWFWFQX-SSEXGKCCSA-N |
| XLogP | 8.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|