C17H26Br2O2 — CID 162871882
[(Z,2R)-1-bromo-5-[(1R,3S)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-3-en-2-yl] acetate (PubChem CID 162871882) has the molecular formula C17H26Br2O2 and a molecular weight of 422.20 g/mol. Its IUPAC name is [(Z,2R)-1-bromo-5-[(1R,3S)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-3-en-2-yl] acetate.
| Compound Name | [(Z,2R)-1-bromo-5-[(1R,3S)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 162871882 |
| Molecular Formula | C17H26Br2O2 |
| Molecular Weight | 422.20 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | [(Z,2R)-1-bromo-5-[(1R,3S)-3-bromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-3-en-2-yl] acetate |
| SMILES | C=C1CC[C@H](Br)C(C)(C)[C@@H]1C/C=C(/C)[C@H](CBr)OC(C)=O |
| InChI | InChI=1S/C17H26Br2O2/c1-11-7-9-16(19)17(4,5)14(11)8-6-12(2)15(10-18)21-13(3)20/h6,14-16H,1,7-10H2,2-5H3/b12-6-/t14-,15+,16+/m1/s1 |
| InChIKey | CAABAOKUTIAZRL-YCINNJIGSA-N |
| XLogP | 5.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.20 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|