C16H25BrO2 — CID 138966602
methyl (E)-5-(3-bromo-2,2-dimethyl-6-methylidenecyclohexyl)-3-methylpent-2-enoate (PubChem CID 138966602) has the molecular formula C16H25BrO2 and a molecular weight of 329.28 g/mol. Its IUPAC name is methyl (E)-5-(3-bromo-2,2-dimethyl-6-methylidenecyclohexyl)-3-methylpent-2-enoate.
| Compound Name | methyl (E)-5-(3-bromo-2,2-dimethyl-6-methylidenecyclohexyl)-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 138966602 |
| Molecular Formula | C16H25BrO2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | methyl (E)-5-(3-bromo-2,2-dimethyl-6-methylidenecyclohexyl)-3-methylpent-2-enoate |
| SMILES | C=C1CCC(Br)C(C)(C)C1CC/C(C)=C/C(=O)OC |
| InChI | InChI=1S/C16H25BrO2/c1-11(10-15(18)19-5)6-8-13-12(2)7-9-14(17)16(13,3)4/h10,13-14H,2,6-9H2,1,3-5H3/b11-10+ |
| InChIKey | RHDAFEPGGPRPGS-ZHACJKMWSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|