C20H22O6 — CID 162873502
[(3R,4E,6Z,12E)-3,14-diacetyloxytetradeca-4,6,12-trien-8,10-diynyl] acetate (PubChem CID 162873502) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is [(3R,4E,6Z,12E)-3,14-diacetyloxytetradeca-4,6,12-trien-8,10-diynyl] acetate.
| Compound Name | [(3R,4E,6Z,12E)-3,14-diacetyloxytetradeca-4,6,12-trien-8,10-diynyl] acetate |
|---|---|
| PubChem CID | 162873502 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(3R,4E,6Z,12E)-3,14-diacetyloxytetradeca-4,6,12-trien-8,10-diynyl] acetate |
| SMILES | CC(=O)OC/C=C/C#CC#C/C=C\C=C\[C@@H](CCOC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H22O6/c1-17(21)24-15-12-10-8-6-4-5-7-9-11-13-20(26-19(3)23)14-16-25-18(2)22/h7,9-13,20H,14-16H2,1-3H3/b9-7-,12-10+,13-11+/t20-/m0/s1 |
| InChIKey | FHMJPDDYIZJLRC-PUYRJQRLSA-N |
| XLogP | 2.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|