C23H26N2O3 — CID 162873905
15b-ethoxy-2,4a,5,5a,7,8,13a,15,15a,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one (PubChem CID 162873905) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 15b-ethoxy-2,4a,5,5a,7,8,13a,15,15a,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one.
| Compound Name | 15b-ethoxy-2,4a,5,5a,7,8,13a,15,15a,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
|---|---|
| PubChem CID | 162873905 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 15b-ethoxy-2,4a,5,5a,7,8,13a,15,15a,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
| SMILES | CCOC12C3CC(=O)N4c5ccccc5C5(CCN6CC(=CCO3)C1CC65)C42 |
| InChI | InChI=1S/C23H26N2O3/c1-2-28-23-16-11-18-22-8-9-24(18)13-14(16)7-10-27-19(23)12-20(26)25(21(22)23)17-6-4-3-5-15(17)22/h3-7,16,18-19,21H,2,8-13H2,1H3 |
| InChIKey | WZEMGGLCLHIQAS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|