C20H26O4 — CID 162874522
(8S)-5-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-6-(2-methylpropanoyl)-8H-chromen-7-one (PubChem CID 162874522) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (8S)-5-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-6-(2-methylpropanoyl)-8H-chromen-7-one.
| Compound Name | (8S)-5-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-6-(2-methylpropanoyl)-8H-chromen-7-one |
|---|---|
| PubChem CID | 162874522 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (8S)-5-hydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-6-(2-methylpropanoyl)-8H-chromen-7-one |
| SMILES | CC(C)=CC[C@@H]1C(=O)C(C(=O)C(C)C)=C(O)C2=C1OC(C)(C)C=C2 |
| InChI | InChI=1S/C20H26O4/c1-11(2)7-8-13-17(22)15(16(21)12(3)4)18(23)14-9-10-20(5,6)24-19(13)14/h7,9-10,12-13,23H,8H2,1-6H3/t13-/m1/s1 |
| InChIKey | OZOBTTQQRGYNPA-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|