C32H46O4 — CID 163093584
(1S,9R,10S,11R)-1,4,4,10-tetramethyl-9-[(2S)-2-methylbutanoyl]-11-(3-methylbut-2-enyl)-10-[(Z)-3-methylpent-2-enyl]-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione (PubChem CID 163093584) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is (1S,9R,10S,11R)-1,4,4,10-tetramethyl-9-[(2S)-2-methylbutanoyl]-11-(3-methylbut-2-enyl)-10-[(Z)-3-methylpent-2-enyl]-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione.
| Compound Name | (1S,9R,10S,11R)-1,4,4,10-tetramethyl-9-[(2S)-2-methylbutanoyl]-11-(3-methylbut-2-enyl)-10-[(Z)-3-methylpent-2-enyl]-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione |
|---|---|
| PubChem CID | 163093584 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | (1S,9R,10S,11R)-1,4,4,10-tetramethyl-9-[(2S)-2-methylbutanoyl]-11-(3-methylbut-2-enyl)-10-[(Z)-3-methylpent-2-enyl]-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione |
| SMILES | CC/C(C)=C\C[C@@]1(C)[C@H](CC=C(C)C)C[C@]2(C)C(=O)[C@@]1(C(=O)[C@@H](C)CC)C(=O)C1=C2OC(C)(C)C=C1 |
| InChI | InChI=1S/C32H46O4/c1-11-21(5)15-18-31(10)23(14-13-20(3)4)19-30(9)27-24(16-17-29(7,8)36-27)26(34)32(31,28(30)35)25(33)22(6)12-2/h13,15-17,22-23H,11-12,14,18-19H2,1-10H3/b21-15-/t22-,23+,30-,31-,32+/m0/s1 |
| InChIKey | KWKZJCILHTXAQD-ZEFSTNIFSA-N |
| XLogP | 7.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|