C19H30O3 — CID 162878274
methyl 2-[(5R)-3,5-diethyl-5-[(2R)-2-ethylhex-3-enyl]furan-2-ylidene]acetate (PubChem CID 162878274) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is methyl 2-[(5R)-3,5-diethyl-5-[(2R)-2-ethylhex-3-enyl]furan-2-ylidene]acetate.
| Compound Name | methyl 2-[(5R)-3,5-diethyl-5-[(2R)-2-ethylhex-3-enyl]furan-2-ylidene]acetate |
|---|---|
| PubChem CID | 162878274 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | methyl 2-[(5R)-3,5-diethyl-5-[(2R)-2-ethylhex-3-enyl]furan-2-ylidene]acetate |
| SMILES | CCC=C[C@H](CC)C[C@]1(CC)C=C(CC)C(=CC(=O)OC)O1 |
| InChI | InChI=1S/C19H30O3/c1-6-10-11-15(7-2)13-19(9-4)14-16(8-3)17(22-19)12-18(20)21-5/h10-12,14-15H,6-9,13H2,1-5H3/t15-,19+/m0/s1 |
| InChIKey | KQEJJCDYCOPPSL-HNAYVOBHSA-N |
| XLogP | 4.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|