C22H40O4 — CID 11595797
methyl 2-[(3S,4S,6R)-4,6-diethyl-6-[(E)-4-ethyl-2-methyloct-5-enyl]dioxan-3-yl]acetate (PubChem CID 11595797) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is methyl 2-[(3S,4S,6R)-4,6-diethyl-6-[(E)-4-ethyl-2-methyloct-5-enyl]dioxan-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4S,6R)-4,6-diethyl-6-[(E)-4-ethyl-2-methyloct-5-enyl]dioxan-3-yl]acetate |
|---|---|
| PubChem CID | 11595797 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | methyl 2-[(3S,4S,6R)-4,6-diethyl-6-[(E)-4-ethyl-2-methyloct-5-enyl]dioxan-3-yl]acetate |
| SMILES | CC/C=C/C(CC)CC(C)C[C@]1(CC)C[C@H](CC)[C@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C22H40O4/c1-7-11-12-18(8-2)13-17(5)15-22(10-4)16-19(9-3)20(25-26-22)14-21(23)24-6/h11-12,17-20H,7-10,13-16H2,1-6H3/b12-11+/t17?,18?,19-,20-,22+/m0/s1 |
| InChIKey | QRDHVGGKSGYWJG-VKUUSHOMSA-N |
| XLogP | 5.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|