C19H34O6 — CID 66559750
methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate (PubChem CID 66559750) has the molecular formula C19H34O6 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate |
|---|---|
| PubChem CID | 66559750 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate |
| SMILES | CCCC(C=O)CCCCC[C@]1(OC)C[C@H](C)[C@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C19H34O6/c1-5-9-16(14-20)10-7-6-8-11-19(23-4)13-15(2)17(24-25-19)12-18(21)22-3/h14-17H,5-13H2,1-4H3/t15-,16?,17-,19+/m0/s1 |
| InChIKey | QQYFKIURAPUULW-SGWQOPTRSA-N |
| XLogP | 3.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|