About methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate
methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate (PubChem CID 66559750) has the molecular formula C19H34O6
and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate |
| PubChem CID | 66559750 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate |
| SMILES | CCCC(C=O)CCCCC[C@]1(OC)C[C@H](C)[C@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C19H34O6/c1-5-9-16(14-20)10-7-6-8-11-19(23-4)13-15(2)17(24-25-19)12-18(21)22-3/h14-17H,5-13H2,1-4H3/t15-,16?,17-,19+/m0/s1 |
| InChIKey | QQYFKIURAPUULW-SGWQOPTRSA-N |
| XLogP | 3.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate?
The IUPAC name of methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate (CID 66559750) is methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate.
What is the SMILES notation for methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate?
The canonical SMILES for methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate is CCCC(C=O)CCCCC[C@]1(OC)C[C@H](C)[C@H](CC(=O)OC)OO1.
What is the InChIKey of methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate?
The InChIKey is QQYFKIURAPUULW-SGWQOPTRSA-N. The full InChI is InChI=1S/C19H34O6/c1-5-9-16(14-20)10-7-6-8-11-19(23-4)13-15(2)17(24-25-19)12-18(21)22-3/h14-17H,5-13H2,1-4H3/t15-,16?,17-,19+/m0/s1.
What are the key properties of methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate?
methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate has a molecular weight of 358.48 g/mol, XLogP of 3.81, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3S,4S,6R)-6-(6-formylnonyl)-6-methoxy-4-methyldioxan-3-yl]acetate is sourced from PubChem (CID 66559750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).