C18H34O4 — CID 10313564
methyl 2-[(3R,4R,6S)-4-ethyl-6-[(2S)-2-ethylhexyl]-6-methyldioxan-3-yl]acetate (PubChem CID 10313564) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is methyl 2-[(3R,4R,6S)-4-ethyl-6-[(2S)-2-ethylhexyl]-6-methyldioxan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,4R,6S)-4-ethyl-6-[(2S)-2-ethylhexyl]-6-methyldioxan-3-yl]acetate |
|---|---|
| PubChem CID | 10313564 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | methyl 2-[(3R,4R,6S)-4-ethyl-6-[(2S)-2-ethylhexyl]-6-methyldioxan-3-yl]acetate |
| SMILES | CCCC[C@H](CC)C[C@@]1(C)C[C@@H](CC)[C@@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C18H34O4/c1-6-9-10-14(7-2)12-18(4)13-15(8-3)16(21-22-18)11-17(19)20-5/h14-16H,6-13H2,1-5H3/t14-,15+,16+,18-/m0/s1 |
| InChIKey | DTJLJWQVJZNNIS-LHHMISFZSA-N |
| XLogP | 4.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|