C16H30O3 — CID 46189219
(3S,4R,6R)-4-ethyl-6-[(2S)-2-ethylhexyl]-6-methyldioxane-3-carbaldehyde (PubChem CID 46189219) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (3S,4R,6R)-4-ethyl-6-[(2S)-2-ethylhexyl]-6-methyldioxane-3-carbaldehyde.
| Compound Name | (3S,4R,6R)-4-ethyl-6-[(2S)-2-ethylhexyl]-6-methyldioxane-3-carbaldehyde |
|---|---|
| PubChem CID | 46189219 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (3S,4R,6R)-4-ethyl-6-[(2S)-2-ethylhexyl]-6-methyldioxane-3-carbaldehyde |
| SMILES | CCCC[C@H](CC)C[C@]1(C)C[C@@H](CC)[C@@H](C=O)OO1 |
| InChI | InChI=1S/C16H30O3/c1-5-8-9-13(6-2)10-16(4)11-14(7-3)15(12-17)18-19-16/h12-15H,5-11H2,1-4H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | RMNBJNSAHVEYMG-ZJIFWQFVSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|