C18H34O3 — CID 46189222
(3R,5R,6S)-5-ethyl-3-[(2S)-2-ethylhexyl]-6-[(E)-2-methoxyethenyl]-3-methyldioxane (PubChem CID 46189222) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is (3R,5R,6S)-5-ethyl-3-[(2S)-2-ethylhexyl]-6-[(E)-2-methoxyethenyl]-3-methyldioxane.
| Compound Name | (3R,5R,6S)-5-ethyl-3-[(2S)-2-ethylhexyl]-6-[(E)-2-methoxyethenyl]-3-methyldioxane |
|---|---|
| PubChem CID | 46189222 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | (3R,5R,6S)-5-ethyl-3-[(2S)-2-ethylhexyl]-6-[(E)-2-methoxyethenyl]-3-methyldioxane |
| SMILES | CCCC[C@H](CC)C[C@]1(C)C[C@@H](CC)[C@@H](/C=C/OC)OO1 |
| InChI | InChI=1S/C18H34O3/c1-6-9-10-15(7-2)13-18(4)14-16(8-3)17(20-21-18)11-12-19-5/h11-12,15-17H,6-10,13-14H2,1-5H3/b12-11+/t15-,16+,17+,18+/m0/s1 |
| InChIKey | QNPYPMHZMJLOLP-FUKIQGOTSA-N |
| XLogP | 5.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|