C21H34O4 — CID 134852096
(E)-3-[(3R,5S)-3,5-diethyl-5-[(1E,4S,5E)-4-ethyl-2-methylocta-1,5-dienyl]dioxolan-3-yl]prop-2-enoic acid (PubChem CID 134852096) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (E)-3-[(3R,5S)-3,5-diethyl-5-[(1E,4S,5E)-4-ethyl-2-methylocta-1,5-dienyl]dioxolan-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(3R,5S)-3,5-diethyl-5-[(1E,4S,5E)-4-ethyl-2-methylocta-1,5-dienyl]dioxolan-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134852096 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (E)-3-[(3R,5S)-3,5-diethyl-5-[(1E,4S,5E)-4-ethyl-2-methylocta-1,5-dienyl]dioxolan-3-yl]prop-2-enoic acid |
| SMILES | CC/C=C/[C@@H](CC)C/C(C)=C/[C@]1(CC)C[C@@](/C=C/C(=O)O)(CC)OO1 |
| InChI | InChI=1S/C21H34O4/c1-6-10-11-18(7-2)14-17(5)15-21(9-4)16-20(8-3,24-25-21)13-12-19(22)23/h10-13,15,18H,6-9,14,16H2,1-5H3,(H,22,23)/b11-10+,13-12+,17-15+/t18-,20+,21-/m1/s1 |
| InChIKey | LPSSNYLPAQXPPZ-KFYZWBJZSA-N |
| XLogP | 5.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|