C14H24O — CID 74051199
7-ethyl-5-methylundeca-4,8-dien-3-one (PubChem CID 74051199) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 7-ethyl-5-methylundeca-4,8-dien-3-one.
| Compound Name | 7-ethyl-5-methylundeca-4,8-dien-3-one |
|---|---|
| PubChem CID | 74051199 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 7-ethyl-5-methylundeca-4,8-dien-3-one |
| SMILES | CCC=CC(CC)CC(C)=CC(=O)CC |
| InChI | InChI=1S/C14H24O/c1-5-8-9-13(6-2)10-12(4)11-14(15)7-3/h8-9,11,13H,5-7,10H2,1-4H3 |
| InChIKey | ADALNYBEFSIJHR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|