C20H34O6 — CID 46871893
(E)-7-[(3S,5R,6R)-6-(carboxymethyl)-3,5-diethyldioxan-3-yl]-4-ethyl-6-methylhept-2-enoic acid (PubChem CID 46871893) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is (E)-7-[(3S,5R,6R)-6-(carboxymethyl)-3,5-diethyldioxan-3-yl]-4-ethyl-6-methylhept-2-enoic acid.
| Compound Name | (E)-7-[(3S,5R,6R)-6-(carboxymethyl)-3,5-diethyldioxan-3-yl]-4-ethyl-6-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 46871893 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (E)-7-[(3S,5R,6R)-6-(carboxymethyl)-3,5-diethyldioxan-3-yl]-4-ethyl-6-methylhept-2-enoic acid |
| SMILES | CCC(/C=C/C(=O)O)CC(C)C[C@@]1(CC)C[C@@H](CC)[C@@H](CC(=O)O)OO1 |
| InChI | InChI=1S/C20H34O6/c1-5-15(8-9-18(21)22)10-14(4)12-20(7-3)13-16(6-2)17(25-26-20)11-19(23)24/h8-9,14-17H,5-7,10-13H2,1-4H3,(H,21,22)(H,23,24)/b9-8+/t14?,15?,16-,17-,20+/m1/s1 |
| InChIKey | MTVPZQQFKNGFPG-DZPAVWSWSA-N |
| XLogP | 4.44 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|