C24H34O4 — CID 162910297
2-[(3S,4S,6S)-6-[(2R,6S)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-4,6-dimethyldioxan-3-yl]acetic acid (PubChem CID 162910297) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 2-[(3S,4S,6S)-6-[(2R,6S)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-4,6-dimethyldioxan-3-yl]acetic acid.
| Compound Name | 2-[(3S,4S,6S)-6-[(2R,6S)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-4,6-dimethyldioxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 162910297 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-[(3S,4S,6S)-6-[(2R,6S)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-4,6-dimethyldioxan-3-yl]acetic acid |
| SMILES | C[C@H](C=Cc1ccccc1)CC=C[C@H](C)C[C@@]1(C)C[C@H](C)[C@H](CC(=O)O)OO1 |
| InChI | InChI=1S/C24H34O4/c1-18(13-14-21-11-6-5-7-12-21)9-8-10-19(2)16-24(4)17-20(3)22(27-28-24)15-23(25)26/h5-8,10-14,18-20,22H,9,15-17H2,1-4H3,(H,25,26)/t18-,19-,20-,22-,24-/m0/s1 |
| InChIKey | SKVQYCUESXDYRX-RNDDGGPQSA-N |
| XLogP | 5.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|