C25H36O3S — CID 11704394
S-ethyl 2-[(3S,5S)-5-[(2R,3E,6S,7E)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-3,5-dimethyldioxolan-3-yl]ethanethioate (PubChem CID 11704394) has the molecular formula C25H36O3S and a molecular weight of 416.63 g/mol. Its IUPAC name is S-ethyl 2-[(3S,5S)-5-[(2R,3E,6S,7E)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-3,5-dimethyldioxolan-3-yl]ethanethioate.
| Compound Name | S-ethyl 2-[(3S,5S)-5-[(2R,3E,6S,7E)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-3,5-dimethyldioxolan-3-yl]ethanethioate |
|---|---|
| PubChem CID | 11704394 |
| Molecular Formula | C25H36O3S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | S-ethyl 2-[(3S,5S)-5-[(2R,3E,6S,7E)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-3,5-dimethyldioxolan-3-yl]ethanethioate |
| SMILES | CCSC(=O)C[C@]1(C)C[C@](C)(C[C@@H](C)/C=C/C[C@H](C)/C=C/c2ccccc2)OO1 |
| InChI | InChI=1S/C25H36O3S/c1-6-29-23(26)18-25(5)19-24(4,27-28-25)17-21(3)12-10-11-20(2)15-16-22-13-8-7-9-14-22/h7-10,12-16,20-21H,6,11,17-19H2,1-5H3/b12-10+,16-15+/t20-,21-,24-,25+/m0/s1 |
| InChIKey | NAPNXERWSAUJCN-FYGGGZNKSA-N |
| XLogP | 6.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|