C23H32O3 — CID 162418262
1-[5-[(2R,3E,6R,7E)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-3,5-dimethyldioxolan-3-yl]ethanone (PubChem CID 162418262) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[5-[(2R,3E,6R,7E)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-3,5-dimethyldioxolan-3-yl]ethanone.
| Compound Name | 1-[5-[(2R,3E,6R,7E)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-3,5-dimethyldioxolan-3-yl]ethanone |
|---|---|
| PubChem CID | 162418262 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 1-[5-[(2R,3E,6R,7E)-2,6-dimethyl-8-phenylocta-3,7-dienyl]-3,5-dimethyldioxolan-3-yl]ethanone |
| SMILES | CC(=O)C1(C)CC(C)(C[C@@H](C)/C=C/C[C@@H](C)/C=C/c2ccccc2)OO1 |
| InChI | InChI=1S/C23H32O3/c1-18(14-15-21-12-7-6-8-13-21)10-9-11-19(2)16-22(4)17-23(5,20(3)24)26-25-22/h6-9,11-15,18-19H,10,16-17H2,1-5H3/b11-9+,15-14+/t18-,19+,22?,23?/m1/s1 |
| InChIKey | CPXPZYMNSCXTRQ-KCGYRVRLSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|