C21H32O3 — CID 11515486
(2R,4S,6R,7E,10S,11E)-4-hydroperoxy-4,6,10-trimethyl-12-phenyldodeca-7,11-dien-2-ol (PubChem CID 11515486) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (2R,4S,6R,7E,10S,11E)-4-hydroperoxy-4,6,10-trimethyl-12-phenyldodeca-7,11-dien-2-ol.
| Compound Name | (2R,4S,6R,7E,10S,11E)-4-hydroperoxy-4,6,10-trimethyl-12-phenyldodeca-7,11-dien-2-ol |
|---|---|
| PubChem CID | 11515486 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (2R,4S,6R,7E,10S,11E)-4-hydroperoxy-4,6,10-trimethyl-12-phenyldodeca-7,11-dien-2-ol |
| SMILES | C[C@H](/C=C/c1ccccc1)C/C=C/[C@H](C)C[C@@](C)(C[C@@H](C)O)OO |
| InChI | InChI=1S/C21H32O3/c1-17(13-14-20-11-6-5-7-12-20)9-8-10-18(2)15-21(4,24-23)16-19(3)22/h5-8,10-14,17-19,22-23H,9,15-16H2,1-4H3/b10-8+,14-13+/t17-,18-,19+,21-/m0/s1 |
| InChIKey | XTHMXOFUSDAFRD-VIXQRXTMSA-N |
| XLogP | 5.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|