C22H34O2 — CID 162881301
2-[(4aR,4bS,8aS)-4b,8,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydrophenanthren-2-yl]propan-2-yl acetate (PubChem CID 162881301) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 2-[(4aR,4bS,8aS)-4b,8,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydrophenanthren-2-yl]propan-2-yl acetate.
| Compound Name | 2-[(4aR,4bS,8aS)-4b,8,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydrophenanthren-2-yl]propan-2-yl acetate |
|---|---|
| PubChem CID | 162881301 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 2-[(4aR,4bS,8aS)-4b,8,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydrophenanthren-2-yl]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)C1=CC2=CC[C@H]3C(C)(C)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C22H34O2/c1-15(23)24-21(4,5)17-9-10-18-16(14-17)8-11-19-20(2,3)12-7-13-22(18,19)6/h8,14,18-19H,7,9-13H2,1-6H3/t18-,19-,22+/m0/s1 |
| InChIKey | JDYQUVYFBYLQIM-CNNODRBYSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |