C21H30O7 — CID 162883277
(1S,2S,7R,9R,13R,14S,15S,16S,17S)-13,16-dihydroxy-4,15-dimethoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-4-ene-3,11-dione (PubChem CID 162883277) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is (1S,2S,7R,9R,13R,14S,15S,16S,17S)-13,16-dihydroxy-4,15-dimethoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-4-ene-3,11-dione.
| Compound Name | (1S,2S,7R,9R,13R,14S,15S,16S,17S)-13,16-dihydroxy-4,15-dimethoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-4-ene-3,11-dione |
|---|---|
| PubChem CID | 162883277 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (1S,2S,7R,9R,13R,14S,15S,16S,17S)-13,16-dihydroxy-4,15-dimethoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-4-ene-3,11-dione |
| SMILES | COC1=CC[C@@H]2C[C@H]3OC(=O)C[C@@]4(O)[C@@H](C)[C@H](OC)[C@@H](O)[C@H]([C@@]2(C)C1=O)[C@@]34C |
| InChI | InChI=1S/C21H30O7/c1-10-16(27-5)15(23)17-19(2)11(6-7-12(26-4)18(19)24)8-13-20(17,3)21(10,25)9-14(22)28-13/h7,10-11,13,15-17,23,25H,6,8-9H2,1-5H3/t10-,11+,13+,15+,16-,17+,19-,20+,21+/m0/s1 |
| InChIKey | ODMCTGSKLFEEBT-ZZQLYNHSSA-N |
| XLogP | 1.21 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |