C16H22O9 — CID 162884808
(2R,3R,4aR,6R,7S,8S,8aR)-2-(4-hydroxy-3-methoxyphenyl)-3,6-bis(hydroxymethyl)-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol (PubChem CID 162884808) has the molecular formula C16H22O9 and a molecular weight of 358.34 g/mol. Its IUPAC name is (2R,3R,4aR,6R,7S,8S,8aR)-2-(4-hydroxy-3-methoxyphenyl)-3,6-bis(hydroxymethyl)-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol.
| Compound Name | (2R,3R,4aR,6R,7S,8S,8aR)-2-(4-hydroxy-3-methoxyphenyl)-3,6-bis(hydroxymethyl)-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol |
|---|---|
| PubChem CID | 162884808 |
| Molecular Formula | C16H22O9 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2R,3R,4aR,6R,7S,8S,8aR)-2-(4-hydroxy-3-methoxyphenyl)-3,6-bis(hydroxymethyl)-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol |
| SMILES | COc1cc([C@H]2O[C@H]3[C@H](O[C@H](CO)[C@@H](O)[C@@H]3O)O[C@@H]2CO)ccc1O |
| InChI | InChI=1S/C16H22O9/c1-22-9-4-7(2-3-8(9)19)14-11(6-18)24-16-15(25-14)13(21)12(20)10(5-17)23-16/h2-4,10-21H,5-6H2,1H3/t10-,11-,12-,13+,14-,15-,16-/m1/s1 |
| InChIKey | SCOGTMHNCINCBN-HQHBRHBDSA-N |
| XLogP | -1.34 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |