C17H24O10 — CID 163014909
(2R,3S,4aR,6S,7S,8S,8aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-bis(hydroxymethyl)-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol (PubChem CID 163014909) has the molecular formula C17H24O10 and a molecular weight of 388.37 g/mol. Its IUPAC name is (2R,3S,4aR,6S,7S,8S,8aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-bis(hydroxymethyl)-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol.
| Compound Name | (2R,3S,4aR,6S,7S,8S,8aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-bis(hydroxymethyl)-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol |
|---|---|
| PubChem CID | 163014909 |
| Molecular Formula | C17H24O10 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2R,3S,4aR,6S,7S,8S,8aR)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-bis(hydroxymethyl)-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol |
| SMILES | COc1cc([C@@H]2O[C@@H]3O[C@@H](CO)[C@@H](O)[C@H](O)[C@H]3O[C@@H]2CO)cc(OC)c1O |
| InChI | InChI=1S/C17H24O10/c1-23-8-3-7(4-9(24-2)12(8)20)15-11(6-19)25-16-14(22)13(21)10(5-18)26-17(16)27-15/h3-4,10-11,13-22H,5-6H2,1-2H3/t10-,11+,13+,14-,15-,16+,17-/m0/s1 |
| InChIKey | UYXZFQQYRZUIEJ-TWTKIZESSA-N |
| XLogP | -1.33 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |