C15H25NO2 — CID 162884858
2-(2-amino-7,9,9-trimethyl-8-oxatricyclo[5.2.2.02,6]undec-4-en-3-yl)ethanol (PubChem CID 162884858) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-(2-amino-7,9,9-trimethyl-8-oxatricyclo[5.2.2.02,6]undec-4-en-3-yl)ethanol.
| Compound Name | 2-(2-amino-7,9,9-trimethyl-8-oxatricyclo[5.2.2.02,6]undec-4-en-3-yl)ethanol |
|---|---|
| PubChem CID | 162884858 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-(2-amino-7,9,9-trimethyl-8-oxatricyclo[5.2.2.02,6]undec-4-en-3-yl)ethanol |
| SMILES | CC1(C)OC2(C)CCC1C1(N)C(CCO)C=CC21 |
| InChI | InChI=1S/C15H25NO2/c1-13(2)11-6-8-14(3,18-13)12-5-4-10(7-9-17)15(11,12)16/h4-5,10-12,17H,6-9,16H2,1-3H3 |
| InChIKey | JGMNKFDMWLFDGY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|