C19H29NO — CID 162885354
(2S,6R,10S,11S)-11-buta-1,3-dienyl-2-penta-2,4-dienyl-1-azaspiro[5.5]undecan-10-ol (PubChem CID 162885354) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (2S,6R,10S,11S)-11-buta-1,3-dienyl-2-penta-2,4-dienyl-1-azaspiro[5.5]undecan-10-ol.
| Compound Name | (2S,6R,10S,11S)-11-buta-1,3-dienyl-2-penta-2,4-dienyl-1-azaspiro[5.5]undecan-10-ol |
|---|---|
| PubChem CID | 162885354 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2S,6R,10S,11S)-11-buta-1,3-dienyl-2-penta-2,4-dienyl-1-azaspiro[5.5]undecan-10-ol |
| SMILES | C=CC=CC[C@@H]1CCC[C@]2(CCC[C@H](O)[C@H]2C=CC=C)N1 |
| InChI | InChI=1S/C19H29NO/c1-3-5-7-10-16-11-8-14-19(20-16)15-9-13-18(21)17(19)12-6-4-2/h3-7,12,16-18,20-21H,1-2,8-11,13-15H2/t16-,17-,18+,19-/m1/s1 |
| InChIKey | DQLZNDOWVBOLDA-AKHDSKFASA-N |
| XLogP | 3.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|