C15H24O4 — CID 162886109
(1S,3aS,7S,9S,9aS,9bR)-7-hydroperoxy-1,9,9a-trimethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-3a-ol (PubChem CID 162886109) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1S,3aS,7S,9S,9aS,9bR)-7-hydroperoxy-1,9,9a-trimethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-3a-ol.
| Compound Name | (1S,3aS,7S,9S,9aS,9bR)-7-hydroperoxy-1,9,9a-trimethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-3a-ol |
|---|---|
| PubChem CID | 162886109 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1S,3aS,7S,9S,9aS,9bR)-7-hydroperoxy-1,9,9a-trimethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-3a-ol |
| SMILES | C[C@@H]1CO[C@@]2(O)CCC3=C[C@@H](OO)C[C@H](C)[C@@]3(C)[C@@H]12 |
| InChI | InChI=1S/C15H24O4/c1-9-8-18-15(16)5-4-11-7-12(19-17)6-10(2)14(11,3)13(9)15/h7,9-10,12-13,16-17H,4-6,8H2,1-3H3/t9-,10+,12+,13-,14-,15+/m1/s1 |
| InChIKey | MUKKKLAKEDIBSB-MOTZAQPNSA-N |
| XLogP | 2.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|